Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:61437
| Name | fructoselysine 6-phosphate |  Download: mol | sdf |
| Synonyms | (2s)-2-azaniumyl-6-{[(3s,4r,5r)-3,4,5-trihydroxy-2-oxo-6-(phosphonatooxy)hexyl]azaniumyl}hexanoate; Fructose l-lysine-6-phosphate; Fructoselysine 6-phosphate; Fructosyllysine 6-phosphate; | |
| Definition | An L-lysine derivative having a 6-phosphofructosyl group attached to the side-chain amino group. | |
| Molecular Weight (Exact mass) | 388.3081 (388.1247) | |
| Molecular Formula | C12H25N2O10P | |
| SMILES | N[C@@H](CCCCNCC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)C(O)=O | |
| InChI | InChI=1S/C12H25N2O10P/c13-7(12(19)20)3-1-2-4-14-5-8(15)10(17)11(18)9(16)6-24-25(21,22)23/h7,9-11,14,16-18H,1-6,13H2,(H,19,20)(H2,21,22,23)/t7-,9+,10+,11+/m0/s1 | |
| InChI Key | ZICZRZZPXBCXCE-AYHFEMFVSA-N | |
| Crosslinking annotations | KEGG:C16489 | ChEBI:61437 | NIKKAJI:J2.802.739G | PubChem:47205785 | |
