Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:597326
| Name | pyridoxal 5'-phosphate(2-) | NA Download: sdf |
| Synonyms | NA; | |
| Definition | The dianion resulting from the removal of two protons from the phosphate group of pyridoxal 5'-phosphate. | |
| Molecular Weight (Exact mass) | NA | |
| Molecular Formula | C8H8NO6P | |
| SMILES | [H]C(=O)c1c(COP([O-])([O-])=O)cnc(C)c1O | |
| InChI | InChI=1S/C8H10NO6P/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h2-3,11H,4H2,1H3,(H2,12,13,14)/p-2 | |
| InChI Key | NGVDGCNFYWLIFO-UHFFFAOYSA-L | |
| Crosslinking annotations | NA |
