Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:58248
| Name | 2,3-bisphosphonato-D-glycerate(5-) | NA Download: sdf |
| Synonyms | NA; | |
| Definition | An organophosphate oxoanion arising from deprotonation of the phospho and carboxy groups of 2,3-bisphospho-D-glyceric acid; major species at pH 7.3. | |
| Molecular Weight (Exact mass) | NA | |
| Molecular Formula | C3H3O10P2 | |
| SMILES | [O-]C(=O)[C@@H](COP([O-])([O-])=O)OP([O-])([O-])=O | |
| InChI | InChI=1S/C3H8O10P2/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11)/p-5/t2-/m1/s1 | |
| InChI Key | XOHUEYCVLUUEJJ-UWTATZPHSA-I | |
| Crosslinking annotations | NA |
