Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:58033
| Name | 2-phosphonatoglycolate(3-) | NA Download: sdf |
| Synonyms | NA; | |
| Definition | Trianion of 2-phosphoglycolic acid arising from deprotonation of the carboxy and phosphate groups; major species at pH 7.3. | |
| Molecular Weight (Exact mass) | NA | |
| Molecular Formula | C2H2O6P | |
| SMILES | [O-]C(=O)COP([O-])([O-])=O | |
| InChI | InChI=1S/C2H5O6P/c3-2(4)1-8-9(5,6)7/h1H2,(H,3,4)(H2,5,6,7)/p-3 | |
| InChI Key | ASCFNMCAHFUBCO-UHFFFAOYSA-K | |
| Crosslinking annotations | NA |
