Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:57693
| Name | aldehydo-D-arabinose 5-phosphate(2-) | NA Download: sdf |
| Synonyms | NA; | |
| Definition | An organophosphate oxoanion that is the dianion of D-arabinose 5-phosphate arising from deprotonation of both phosphate OH groups; major species at pH 7.3. | |
| Molecular Weight (Exact mass) | NA | |
| Molecular Formula | C5H9O8P | |
| SMILES | [H]C(=O)[C@@H](O)[C@H](O)[C@H](O)COP([O-])([O-])=O | |
| InChI | InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/p-2/t3-,4-,5+/m1/s1 | |
| InChI Key | PPQRONHOSHZGFQ-WDCZJNDASA-L | |
| Crosslinking annotations | NA |
