Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:18405
| Name | pyridoxal 5'-phosphate |  Download: mol | sdf |
| Synonyms | (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl phosphate; 3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]-4-pyridinecarboxaldehyde; 3-hydroxy-5-(hydroxymethyl)-2-methylisonicotinaldehyde 5-phosphate; Codecarboxylase; Phosphoric acid mono-(4-formyl-5-hydroxy-6-methyl-pyridin-3-ylmethyl) ester; Plp; Pyridoxal 5'-phosphate; Pyridoxal 5-monophosphoric acid ester; Pyridoxal 5-phosphate; Pyridoxal phosphate; Pyridoxal-5'-phosphate; | |
| Definition | The monophosphate ester obtained by condensation of phosphoric acid with the primary hydroxy group of pyridoxal. | |
| Molecular Weight (Exact mass) | 247.1419 (247.0246) | |
| Molecular Formula | C8H10NO6P | |
| SMILES | [H]C(=O)c1c(COP(O)(O)=O)cnc(C)c1O | |
| InChI | InChI=1S/C8H10NO6P/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h2-3,11H,4H2,1H3,(H2,12,13,14) | |
| InChI Key | NGVDGCNFYWLIFO-UHFFFAOYSA-N | |
| Crosslinking annotations | KEGG:C00018 | 3DMET:B00005 | CAS:54-47-7 | ChEBI:18405 | ChEMBL:CHEMBL82202 | KNApSAcK:C00007503 | NIKKAJI:J10.690I | PDB-CCD:PLP | PubChem:3320 | |
