Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:18335
| Name | pyridoxamine 5'-phosphate |  Download: mol | sdf |
| Synonyms | 4'-deoxy-4'-aminopyridoxal-5'-phosphate; Pmp; Pyridoxamine 5'-phosphate; Pyridoxamine 5-phosphate; Pyridoxamine phosphate; [4-(ammoniomethyl)-5-hydroxy-6-methylpyridin-3-yl]methyl phosphate; | |
| Definition | A vitamin B6 phosphate that is the phosphoric ester derivative of pyridoxamine. | |
| Molecular Weight (Exact mass) | 248.173 (248.0562) | |
| Molecular Formula | C8H13N2O5P | |
| SMILES | Cc1ncc(COP(O)(O)=O)c(CN)c1O | |
| InChI | InChI=1S/C8H13N2O5P/c1-5-8(11)7(2-9)6(3-10-5)4-15-16(12,13)14/h3,11H,2,4,9H2,1H3,(H2,12,13,14) | |
| InChI Key | ZMJGSOSNSPKHNH-UHFFFAOYSA-N | |
| Crosslinking annotations | KEGG:C00647 | 3DMET:B00154 | CAS:529-96-4 | ChEBI:18335 | ChEMBL:CHEMBL1235353 | KNApSAcK:C00007506 | NIKKAJI:J11.364F | PDB-CCD:PMP | PubChem:3919 | |
