Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:18297
| Name | 1D-myo-inositol 1-phosphate |  Download: mol | sdf |
| Synonyms | (1s,2r,3r,4s,5s,6r)-2,3,4,5,6-pentahydroxycyclohexyl phosphate; 1d-myo-inositol 1-phosphate; 1d-myo-inositol 1-monophosphate; 1d-myo-inositol 1-phosphate; D-myo-inositol 1-phosphate; Inositol 1-phosphate; Ins(1)p1; Myo-inositol 1-phosphate; Myoinositol 1-phosphate; | |
| Definition | An inositol having myo- configuration substituted at position 1 by a phosphate group. | |
| Molecular Weight (Exact mass) | 260.1358 (260.0297) | |
| Molecular Formula | C6H13O9P | |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)[C@H](OP(O)(O)=O)[C@H](O)[C@@H]1O | |
| InChI | InChI=1S/C6H13O9P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-11H,(H2,12,13,14)/t1-,2-,3+,4-,5-,6-/m1/s1 | |
| InChI Key | INAPMGSXUVUWAF-UOTPTPDRSA-N | |
| Crosslinking annotations | KEGG:C01177 | 3DMET:B01403 | ChEBI:18297 | ChEMBL:CHEMBL3959608 | KNApSAcK:C00007483 | NIKKAJI:J6.548J | PDB-CCD:IPD | PubChem:4404 | |
