Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:17622
| Name | dUMP |  Download: mol | sdf |
| Synonyms | 2'-deoxyuridine 5'-monophosphate; 2'-deoxyuridine 5'-phosphate; 2'-deoxy-5'-o-phosphonatouridine; 5'-dump; Deoxyuridine 5'-phosphate; Deoxyuridine monophosphate; Deoxyuridylate; Deoxyuridylic acid; Dump; | |
| Definition | A pyrimidine 2'-deoxyribonucleoside 5'-monophosphate having uracil as the nucleobase. | |
| Molecular Weight (Exact mass) | 308.1819 (308.041) | |
| Molecular Formula | C9H13N2O8P | |
| SMILES | O[C@H]1C[C@@H](O[C@@H]1COP(O)(O)=O)n1ccc(=O)[nH]c1=O | |
| InChI | InChI=1S/C9H13N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 | |
| InChI Key | JSRLJPSBLDHEIO-SHYZEUOFSA-N | |
| Crosslinking annotations | KEGG:C00365 | 3DMET:B01231 | CAS:964-26-1 | ChEBI:17622 | ChEMBL:CHEMBL211312 | KNApSAcK:C00019282 | NIKKAJI:J298.569A | PDB-CCD:DU | PDB-CCD:UMP | PubChem:3656 | |
