Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:15784
| Name | N-acetyl-D-glucosamine 6-phosphate |  Download: mol | sdf |
| Synonyms | 2-acetamido-2-deoxy-6-o-phosphono-d-glucopyranose; 2-acetamido-2-deoxy-d-glucopyranose 6-phosphate; N-acetyl-d-glucosamine 6-phosphate; | |
| Definition | An N-acyl-D-glucosamine 6-phosphate that is the N-acetyl derivative of D-glucosamine 6-phosphate. It is a component of the aminosugar metabolism. | |
| Molecular Weight (Exact mass) | 301.1877 (301.0563) | |
| Molecular Formula | C8H16NO9P | |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O | |
| InChI | InChI=1S/C8H16NO9P/c1-3(10)9-5-7(12)6(11)4(18-8(5)13)2-17-19(14,15)16/h4-8,11-13H,2H2,1H3,(H,9,10)(H2,14,15,16)/t4-,5-,6-,7-,8?/m1/s1 | |
| InChI Key | BRGMHAYQAZFZDJ-RTRLPJTCSA-N | |
| Crosslinking annotations | KEGG:C00357 | 3DMET:B01225 | ChEBI:15784 | NIKKAJI:J1.734.828K | PDB-CCD:16G | PDB-CCD:4QY | PubChem:3650 | |
