Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
CHEBI:15442
| Name | presqualene diphosphate |  Download: mol | sdf |
| Synonyms | Presqualene diphosphate; Psdp; [(1r,2r,3r)-2-[(e)-4,8-dimethylnona-3,7-dienyl]-2-methyl-3-[(2e,6e)-2,6,10-trimethylundeca-1,5,9-trienyl]cyclopropan-1-yl]methyl diphosphate; {(1r,2r,3r)-2-[(3e)-4,8-dimethylnona-3,7-dien-1-yl]-2-methyl-3-[(2e,6e)-2,6,10-trimethylundeca-1,5,9-trien-1-yl]cyclopropan-1-yl}methyl diphosphate; | |
| Definition | A triterpenyl phosphate that is presqualene in which the hydroxy hydrogen has been replaced by a diphosphate group. | |
| Molecular Weight (Exact mass) | 586.6772 (586.3188) | |
| Molecular Formula | C30H52O7P2 | |
| SMILES | [H][C@]1(COP(O)(=O)OP(O)(O)=O)[C@]([H])(\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@]1(C)CC\C=C(/C)CCC=C(C)C | |
| InChI | InChI=1S/C30H52O7P2/c1-23(2)13-9-15-25(5)17-11-18-27(7)21-28-29(22-36-39(34,35)37-38(31,32)33)30(28,8)20-12-19-26(6)16-10-14-24(3)4/h13-14,17,19,21,28-29H,9-12,15-16,18,20,22H2,1-8H3,(H,34,35)(H2,31,32,33)/b25-17+,26-19+,27-21+/t28-,29-,30-/m0/s1 | |
| InChI Key | ATZKAUGGNMSCCY-VYCBRMPGSA-N | |
| Crosslinking annotations | KEGG:C03428 | 3DMET:B01658 | ChEBI:15442 | LIPIDMAPS:LMPR0106010003 | NIKKAJI:J816.761C | PDB-CCD:PS7 | PubChem:6255 | |
